C49H46Br2N2O2 — CID 102404329
2-[6-(2,7-dibromo-9-hexylfluoren-9-yl)hexyl]-6-(N-phenylanilino)benzo[de]isoquinoline-1,3-dione (PubChem CID 102404329) has the molecular formula C49H46Br2N2O2 and a molecular weight of 854.73 g/mol. Its IUPAC name is 2-[6-(2,7-dibromo-9-hexylfluoren-9-yl)hexyl]-6-(N-phenylanilino)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[6-(2,7-dibromo-9-hexylfluoren-9-yl)hexyl]-6-(N-phenylanilino)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102404329 |
| Molecular Formula | C49H46Br2N2O2 |
| Molecular Weight | 854.73 g/mol |
| Exact Mass | 852.19 |
| IUPAC Name | 2-[6-(2,7-dibromo-9-hexylfluoren-9-yl)hexyl]-6-(N-phenylanilino)benzo[de]isoquinoline-1,3-dione |
| SMILES | CCCCCCC1(CCCCCCN2C(=O)c3cccc4c(N(c5ccccc5)c5ccccc5)ccc(c34)C2=O)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C49H46Br2N2O2/c1-2-3-4-13-29-49(43-32-34(50)23-25-38(43)39-26-24-35(51)33-44(39)49)30-14-5-6-15-31-52-47(54)41-22-16-21-40-45(28-27-42(46(40)41)48(52)55)53(36-17-9-7-10-18-36)37-19-11-8-12-20-37/h7-12,16-28,32-33H,2-6,13-15,29-31H2,1H3 |
| InChIKey | NMNDUUKQOSSDGB-UHFFFAOYSA-N |
| XLogP | 14.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.73 |
| LogP ≤ 5 | 14.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|