C19H20N2O4 — CID 59398495
4-[6-(dimethylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]-2-methylbutanoic acid (PubChem CID 59398495) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[6-(dimethylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]-2-methylbutanoic acid.
| Compound Name | 4-[6-(dimethylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 59398495 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-[6-(dimethylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]-2-methylbutanoic acid |
| SMILES | CC(CCN1C(=O)c2cccc3c(N(C)C)ccc(c23)C1=O)C(=O)O |
| InChI | InChI=1S/C19H20N2O4/c1-11(19(24)25)9-10-21-17(22)13-6-4-5-12-15(20(2)3)8-7-14(16(12)13)18(21)23/h4-8,11H,9-10H2,1-3H3,(H,24,25) |
| InChIKey | VWMQWWJTLJODJW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|