C37H33NO6 — CID 145156636
6-hex-1-ynyl-2-hydroxybenzo[de]isoquinoline-1,3-dione;8-hex-1-ynyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;methane (PubChem CID 145156636) has the molecular formula C37H33NO6 and a molecular weight of 587.67 g/mol. Its IUPAC name is 6-hex-1-ynyl-2-hydroxybenzo[de]isoquinoline-1,3-dione;8-hex-1-ynyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;methane.
| Compound Name | 6-hex-1-ynyl-2-hydroxybenzo[de]isoquinoline-1,3-dione;8-hex-1-ynyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;methane |
|---|---|
| PubChem CID | 145156636 |
| Molecular Formula | C37H33NO6 |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 587.23 |
| IUPAC Name | 6-hex-1-ynyl-2-hydroxybenzo[de]isoquinoline-1,3-dione;8-hex-1-ynyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione;methane |
| SMILES | C.CCCCC#Cc1ccc2c3c(cccc13)C(=O)N(O)C2=O.CCCCC#Cc1ccc2c3c(cccc13)C(=O)OC2=O |
| InChI | InChI=1S/C18H15NO3.C18H14O3.CH4/c1-2-3-4-5-7-12-10-11-15-16-13(12)8-6-9-14(16)17(20)19(22)18(15)21;1-2-3-4-5-7-12-10-11-15-16-13(12)8-6-9-14(16)17(19)21-18(15)20;/h6,8-11,22H,2-4H2,1H3;6,8-11H,2-4H2,1H3;1H4 |
| InChIKey | UNNSABJOIBNEAZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|