C19H23ClN4O3 — CID 71608132
2-amino-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]propanamide;hydrochloride (PubChem CID 71608132) has the molecular formula C19H23ClN4O3 and a molecular weight of 390.87 g/mol. Its IUPAC name is 2-amino-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]propanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 71608132 |
| Molecular Formula | C19H23ClN4O3 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-amino-N-[2-[2-(dimethylamino)ethyl]-1,3-dioxobenzo[de]isoquinolin-6-yl]propanamide;hydrochloride |
| SMILES | CC(N)C(=O)Nc1ccc2c3c(cccc13)C(=O)N(CCN(C)C)C2=O.Cl |
| InChI | InChI=1S/C19H22N4O3.ClH/c1-11(20)17(24)21-15-8-7-14-16-12(15)5-4-6-13(16)18(25)23(19(14)26)10-9-22(2)3;/h4-8,11H,9-10,20H2,1-3H3,(H,21,24);1H |
| InChIKey | JMUFGLXKJXFEGP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|