C22H21N3O3 — CID 10339437
N-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-10-yl]acetamide (PubChem CID 10339437) has the molecular formula C22H21N3O3 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-10-yl]acetamide.
| Compound Name | N-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-10-yl]acetamide |
|---|---|
| PubChem CID | 10339437 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-10-yl]acetamide |
| SMILES | CC(=O)NC1=CC=C2C3=C(C4=CC=CC=C4C=C13)C(=O)N(C2=O)CCN(C)C |
| InChI | InChI=1S/C22H21N3O3/c1-13(26)23-18-9-8-16-19-17(18)12-14-6-4-5-7-15(14)20(19)22(28)25(21(16)27)11-10-24(2)3/h4-9,12H,10-11H2,1-3H3,(H,23,26) |
| InChIKey | FKEWXRZPQBDMBW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 69.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | 649 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|