C24H23N3O4 — CID 87507243
[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-6-yl]-prop-2-enylcarbamic acid (PubChem CID 87507243) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is [15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-6-yl]-prop-2-enylcarbamic acid.
| Compound Name | [15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-6-yl]-prop-2-enylcarbamic acid |
|---|---|
| PubChem CID | 87507243 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-6-yl]-prop-2-enylcarbamic acid |
| SMILES | C=CCN(C(=O)O)c1cccc2c3c4c(cccc4cc12)C(=O)N(CCN(C)C)C3=O |
| InChI | InChI=1S/C24H23N3O4/c1-4-11-26(24(30)31)19-10-6-8-16-18(19)14-15-7-5-9-17-20(15)21(16)23(29)27(22(17)28)13-12-25(2)3/h4-10,14H,1,11-13H2,2-3H3,(H,30,31) |
| InChIKey | ILBZPPFJORIJSS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|