C27H21F2N3O2 — CID 16718373
3-[(2,3-difluorophenyl)methylideneamino]-15-[2-(dimethylamino)ethyl]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione (PubChem CID 16718373) has the molecular formula C27H21F2N3O2 and a molecular weight of 457.48 g/mol. Its IUPAC name is 3-[(2,3-difluorophenyl)methylideneamino]-15-[2-(dimethylamino)ethyl]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione.
| Compound Name | 3-[(2,3-difluorophenyl)methylideneamino]-15-[2-(dimethylamino)ethyl]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione |
|---|---|
| PubChem CID | 16718373 |
| Molecular Formula | C27H21F2N3O2 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 3-[(2,3-difluorophenyl)methylideneamino]-15-[2-(dimethylamino)ethyl]-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaene-14,16-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3cc4cccc(/N=C/c5cccc(F)c5F)c4c(c23)C1=O |
| InChI | InChI=1S/C27H21F2N3O2/c1-31(2)12-13-32-26(33)19-9-3-6-16-14-17-7-5-11-21(23(17)24(22(16)19)27(32)34)30-15-18-8-4-10-20(28)25(18)29/h3-11,14-15H,12-13H2,1-2H3/b30-15+ |
| InChIKey | OATWGJFUKMHMLU-FJEPWZHXSA-N |
| XLogP | 5.18 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|