C30H29F3N4O3S — CID 143454717
1-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-3-yl]-3-[4-(trifluoromethoxy)phenyl]thiourea;ethane (PubChem CID 143454717) has the molecular formula C30H29F3N4O3S and a molecular weight of 582.65 g/mol. Its IUPAC name is 1-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-3-yl]-3-[4-(trifluoromethoxy)phenyl]thiourea;ethane.
| Compound Name | 1-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-3-yl]-3-[4-(trifluoromethoxy)phenyl]thiourea;ethane |
|---|---|
| PubChem CID | 143454717 |
| Molecular Formula | C30H29F3N4O3S |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 1-[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-3-yl]-3-[4-(trifluoromethoxy)phenyl]thiourea;ethane |
| SMILES | CC.CN(C)CCN1C(=O)c2cccc3cc4cccc(NC(=S)Nc5ccc(OC(F)(F)F)cc5)c4c(c23)C1=O |
| InChI | InChI=1S/C28H23F3N4O3S.C2H6/c1-34(2)13-14-35-25(36)20-7-3-5-16-15-17-6-4-8-21(23(17)24(22(16)20)26(35)37)33-27(39)32-18-9-11-19(12-10-18)38-28(29,30)31;1-2/h3-12,15H,13-14H2,1-2H3,(H2,32,33,39);1-2H3 |
| InChIKey | GARSRGXMJBVUKB-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|