C32H34N4O2 — CID 85470102
16-[2-[bis[2-(dimethylamino)ethyl]amino]ethyl]-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione (PubChem CID 85470102) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 16-[2-[bis[2-(dimethylamino)ethyl]amino]ethyl]-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione.
| Compound Name | 16-[2-[bis[2-(dimethylamino)ethyl]amino]ethyl]-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione |
|---|---|
| PubChem CID | 85470102 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 16-[2-[bis[2-(dimethylamino)ethyl]amino]ethyl]-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(21),2,4,6(23),7,9,11,13,18(22),19-decaene-15,17-dione |
| SMILES | CN(C)CCN(CCN(C)C)CCN1C(=O)c2ccc3c4cccc5cccc(c6ccc(c2c36)C1=O)c54 |
| InChI | InChI=1S/C32H34N4O2/c1-33(2)15-17-35(18-16-34(3)4)19-20-36-31(37)26-13-11-24-22-9-5-7-21-8-6-10-23(28(21)22)25-12-14-27(32(36)38)30(26)29(24)25/h5-14H,15-20H2,1-4H3 |
| InChIKey | JHCJELDSWNDHDW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|