C16H15N3O4 — CID 21327568
2-[2-(dimethylamino)ethyl]-4-nitrobenzo[e]isoindole-1,3-dione (PubChem CID 21327568) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethyl]-4-nitrobenzo[e]isoindole-1,3-dione.
| Compound Name | 2-[2-(dimethylamino)ethyl]-4-nitrobenzo[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21327568 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-[2-(dimethylamino)ethyl]-4-nitrobenzo[e]isoindole-1,3-dione |
| SMILES | CN(C)CCN1C(=O)c2c([N+](=O)[O-])cc3ccccc3c2C1=O |
| InChI | InChI=1S/C16H15N3O4/c1-17(2)7-8-18-15(20)13-11-6-4-3-5-10(11)9-12(19(22)23)14(13)16(18)21/h3-6,9H,7-8H2,1-2H3 |
| InChIKey | IEFVPOZHDZCJCR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|