C16H16BrN3O2 — CID 15154346
8-bromo-2-[2-(dimethylamino)ethyl]-4-methylpyrrolo[3,4-c]quinoline-1,3-dione (PubChem CID 15154346) has the molecular formula C16H16BrN3O2 and a molecular weight of 362.23 g/mol. Its IUPAC name is 8-bromo-2-[2-(dimethylamino)ethyl]-4-methylpyrrolo[3,4-c]quinoline-1,3-dione.
| Compound Name | 8-bromo-2-[2-(dimethylamino)ethyl]-4-methylpyrrolo[3,4-c]quinoline-1,3-dione |
|---|---|
| PubChem CID | 15154346 |
| Molecular Formula | C16H16BrN3O2 |
| Molecular Weight | 362.23 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 8-bromo-2-[2-(dimethylamino)ethyl]-4-methylpyrrolo[3,4-c]quinoline-1,3-dione |
| SMILES | Cc1nc2ccc(Br)cc2c2c1C(=O)N(CCN(C)C)C2=O |
| InChI | InChI=1S/C16H16BrN3O2/c1-9-13-14(11-8-10(17)4-5-12(11)18-9)16(22)20(15(13)21)7-6-19(2)3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | DWVWTVHJBKOVKV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|