C21H25N3O — CID 144908958
14-[2-(dimethylamino)ethyl]-4-methyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9(16),10,12-heptaen-15-one;ethane (PubChem CID 144908958) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is 14-[2-(dimethylamino)ethyl]-4-methyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9(16),10,12-heptaen-15-one;ethane.
| Compound Name | 14-[2-(dimethylamino)ethyl]-4-methyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9(16),10,12-heptaen-15-one;ethane |
|---|---|
| PubChem CID | 144908958 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 14-[2-(dimethylamino)ethyl]-4-methyl-8,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-1,3,5,7,9(16),10,12-heptaen-15-one;ethane |
| SMILES | CC.Cc1ccc2nc3cccc4c3c(c2c1)C(=O)N4CCN(C)C |
| InChI | InChI=1S/C19H19N3O.C2H6/c1-12-7-8-14-13(11-12)17-18-15(20-14)5-4-6-16(18)22(19(17)23)10-9-21(2)3;1-2/h4-8,11H,9-10H2,1-3H3;1-2H3 |
| InChIKey | QKAVGNOVFHYUGN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|