C52H56N6O8 — CID 59322872
N,N'-bis[2-[2-(10-methoxy-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-15-yl)ethyl-methylamino]ethyl]octanediamide (PubChem CID 59322872) has the molecular formula C52H56N6O8 and a molecular weight of 893.05 g/mol. Its IUPAC name is N,N'-bis[2-[2-(10-methoxy-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-15-yl)ethyl-methylamino]ethyl]octanediamide.
| Compound Name | N,N'-bis[2-[2-(10-methoxy-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-15-yl)ethyl-methylamino]ethyl]octanediamide |
|---|---|
| PubChem CID | 59322872 |
| Molecular Formula | C52H56N6O8 |
| Molecular Weight | 893.05 g/mol |
| Exact Mass | 892.42 |
| IUPAC Name | N,N'-bis[2-[2-(10-methoxy-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,10,12-heptaen-15-yl)ethyl-methylamino]ethyl]octanediamide |
| SMILES | COc1ccc2c3c(c4ccccc4cc13)C(=O)N(CCN(C)CCNC(=O)CCCCCCC(=O)NCCN(C)CCN1C(=O)c3ccc(OC)c4cc5ccccc5c(c34)C1=O)C2=O |
| InChI | InChI=1S/C52H56N6O8/c1-55(27-29-57-49(61)37-19-21-41(65-3)39-31-33-13-9-11-15-35(33)47(45(37)39)51(57)63)25-23-53-43(59)17-7-5-6-8-18-44(60)54-24-26-56(2)28-30-58-50(62)38-20-22-42(66-4)40-32-34-14-10-12-16-36(34)48(46(38)40)52(58)64/h9-16,19-22,31-32H,5-8,17-18,23-30H2,1-4H3,(H,53,59)(H,54,60) |
| InChIKey | CCWWFHICIOHORG-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 157.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.05 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|