C25H24N2O4 — CID 4090192
6-(1,3-dioxoisoindol-2-yl)-N-(4-methoxynaphthalen-1-yl)hexanamide (PubChem CID 4090192) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-(4-methoxynaphthalen-1-yl)hexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-(4-methoxynaphthalen-1-yl)hexanamide |
|---|---|
| PubChem CID | 4090192 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-(4-methoxynaphthalen-1-yl)hexanamide |
| SMILES | COc1ccc(NC(=O)CCCCCN2C(=O)c3ccccc3C2=O)c2ccccc12 |
| InChI | InChI=1S/C25H24N2O4/c1-31-22-15-14-21(17-9-4-5-10-18(17)22)26-23(28)13-3-2-8-16-27-24(29)19-11-6-7-12-20(19)25(27)30/h4-7,9-12,14-15H,2-3,8,13,16H2,1H3,(H,26,28) |
| InChIKey | XDRNLMAIRKPCSJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|