C27H34N2O4 — CID 3362630
11-(1,3-dioxoisoindol-2-yl)-N-(2-ethoxyphenyl)undecanamide (PubChem CID 3362630) has the molecular formula C27H34N2O4 and a molecular weight of 450.58 g/mol. Its IUPAC name is 11-(1,3-dioxoisoindol-2-yl)-N-(2-ethoxyphenyl)undecanamide.
| Compound Name | 11-(1,3-dioxoisoindol-2-yl)-N-(2-ethoxyphenyl)undecanamide |
|---|---|
| PubChem CID | 3362630 |
| Molecular Formula | C27H34N2O4 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 11-(1,3-dioxoisoindol-2-yl)-N-(2-ethoxyphenyl)undecanamide |
| SMILES | CCOc1ccccc1NC(=O)CCCCCCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H34N2O4/c1-2-33-24-18-13-12-17-23(24)28-25(30)19-9-7-5-3-4-6-8-14-20-29-26(31)21-15-10-11-16-22(21)27(29)32/h10-13,15-18H,2-9,14,19-20H2,1H3,(H,28,30) |
| InChIKey | UBQMUMXBEFTSEE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|