C25H29N3O6S — CID 4844189
4-(1,3-dioxoisoindol-2-yl)-N-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)butanamide (PubChem CID 4844189) has the molecular formula C25H29N3O6S and a molecular weight of 499.59 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 4844189 |
| Molecular Formula | C25H29N3O6S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-(2-ethoxy-5-piperidin-1-ylsulfonylphenyl)butanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H29N3O6S/c1-2-34-22-13-12-18(35(32,33)27-14-6-3-7-15-27)17-21(22)26-23(29)11-8-16-28-24(30)19-9-4-5-10-20(19)25(28)31/h4-5,9-10,12-13,17H,2-3,6-8,11,14-16H2,1H3,(H,26,29) |
| InChIKey | AZYCRODBHIMMPZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|