C28H27N3O5 — CID 58919564
2-[5-(1,3-dioxoisoindol-2-yl)pentanoylamino]-N-(2-ethoxyphenyl)benzamide (PubChem CID 58919564) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is 2-[5-(1,3-dioxoisoindol-2-yl)pentanoylamino]-N-(2-ethoxyphenyl)benzamide.
| Compound Name | 2-[5-(1,3-dioxoisoindol-2-yl)pentanoylamino]-N-(2-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 58919564 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 2-[5-(1,3-dioxoisoindol-2-yl)pentanoylamino]-N-(2-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccccc1NC(=O)CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H27N3O5/c1-2-36-24-16-8-7-15-23(24)30-26(33)21-13-5-6-14-22(21)29-25(32)17-9-10-18-31-27(34)19-11-3-4-12-20(19)28(31)35/h3-8,11-16H,2,9-10,17-18H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | ZOFHHOQYOUANQU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|