C19H19N3O4 — CID 4018238
6-(1,3-dioxoisoindol-2-yl)-N-(2-oxo-1H-pyridin-3-yl)hexanamide (PubChem CID 4018238) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-(2-oxo-1H-pyridin-3-yl)hexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-(2-oxo-1H-pyridin-3-yl)hexanamide |
|---|---|
| PubChem CID | 4018238 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-(2-oxo-1H-pyridin-3-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)Nc1ccc[nH]c1=O |
| InChI | InChI=1S/C19H19N3O4/c23-16(21-15-9-6-11-20-17(15)24)10-2-1-5-12-22-18(25)13-7-3-4-8-14(13)19(22)26/h3-4,6-9,11H,1-2,5,10,12H2,(H,20,24)(H,21,23) |
| InChIKey | ZSXOGFXIMJPSTO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|