C19H19N3O3 — CID 565136
6-(1,3-dioxoisoindol-2-yl)-N-pyridin-2-ylhexanamide (PubChem CID 565136) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 6-(1,3-dioxoisoindol-2-yl)-N-pyridin-2-ylhexanamide.
| Compound Name | 6-(1,3-dioxoisoindol-2-yl)-N-pyridin-2-ylhexanamide |
|---|---|
| PubChem CID | 565136 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 6-(1,3-dioxoisoindol-2-yl)-N-pyridin-2-ylhexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2C1=O)Nc1ccccn1 |
| InChI | InChI=1S/C19H19N3O3/c23-17(21-16-10-5-6-12-20-16)11-2-1-7-13-22-18(24)14-8-3-4-9-15(14)19(22)25/h3-6,8-10,12H,1-2,7,11,13H2,(H,20,21,23) |
| InChIKey | PJIIHWQOUWTGSS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|