C19H19N3O3 — CID 91114387
5-(1,3-dioxoisoindol-2-yl)-4-methyl-N-pyridin-2-ylpentanamide (PubChem CID 91114387) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)-4-methyl-N-pyridin-2-ylpentanamide.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)-4-methyl-N-pyridin-2-ylpentanamide |
|---|---|
| PubChem CID | 91114387 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)-4-methyl-N-pyridin-2-ylpentanamide |
| SMILES | CC(CCC(=O)Nc1ccccn1)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H19N3O3/c1-13(9-10-17(23)21-16-8-4-5-11-20-16)12-22-18(24)14-6-2-3-7-15(14)19(22)25/h2-8,11,13H,9-10,12H2,1H3,(H,20,21,23) |
| InChIKey | YNNXYNIYRKUHIK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|