C14H16N2O3 — CID 142645113
N-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide (PubChem CID 142645113) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide.
| Compound Name | N-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 142645113 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-(1,3-dioxoisoindol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H16N2O3/c1-9(2)7-8-12(17)15-16-13(18)10-5-3-4-6-11(10)14(16)19/h3-6,9H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | RXUFDWMCHNWIEA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|