C20H16F3N3O4 — CID 108933494
4-(1,3-dioxoisoindol-2-yl)-N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]butanamide (PubChem CID 108933494) has the molecular formula C20H16F3N3O4 and a molecular weight of 419.36 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 108933494 |
| Molecular Formula | C20H16F3N3O4 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[2-[(2,2,2-trifluoroacetyl)amino]phenyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1ccccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H16F3N3O4/c21-20(22,23)19(30)25-15-9-4-3-8-14(15)24-16(27)10-5-11-26-17(28)12-6-1-2-7-13(12)18(26)29/h1-4,6-9H,5,10-11H2,(H,24,27)(H,25,30) |
| InChIKey | KPAUDIGMOQSVES-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|