C21H18F3N3O4 — CID 108934170
4-(1,3-dioxoisoindol-2-yl)-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]butanamide (PubChem CID 108934170) has the molecular formula C21H18F3N3O4 and a molecular weight of 433.39 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 108934170 |
| Molecular Formula | C21H18F3N3O4 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[[2-[(2,2,2-trifluoroacetyl)amino]phenyl]methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)NCc1ccccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H18F3N3O4/c22-21(23,24)20(31)26-16-9-4-1-6-13(16)12-25-17(28)10-5-11-27-18(29)14-7-2-3-8-15(14)19(27)30/h1-4,6-9H,5,10-12H2,(H,25,28)(H,26,31) |
| InChIKey | CSSNGROHUQNQDW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|