C25H20F3N3O4 — CID 26686954
2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoylamino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 26686954) has the molecular formula C25H20F3N3O4 and a molecular weight of 483.45 g/mol. Its IUPAC name is 2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoylamino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoylamino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 26686954 |
| Molecular Formula | C25H20F3N3O4 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butanoylamino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)Nc1ccccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C25H20F3N3O4/c26-25(27,28)14-29-22(33)16-8-1-2-11-19(16)30-20(32)12-5-13-31-23(34)17-9-3-6-15-7-4-10-18(21(15)17)24(31)35/h1-4,6-11H,5,12-14H2,(H,29,33)(H,30,32) |
| InChIKey | FIWGKGSZHULOKH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|