C25H20N4O3 — CID 55647602
4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-pyrazol-1-ylphenyl)butanamide (PubChem CID 55647602) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-pyrazol-1-ylphenyl)butanamide.
| Compound Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-pyrazol-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 55647602 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)-N-(2-pyrazol-1-ylphenyl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2cccc3cccc(c23)C1=O)Nc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C25H20N4O3/c30-22(27-20-11-1-2-12-21(20)29-16-6-14-26-29)13-5-15-28-24(31)18-9-3-7-17-8-4-10-19(23(17)18)25(28)32/h1-4,6-12,14,16H,5,13,15H2,(H,27,30) |
| InChIKey | LTIAVFLVCZQFJH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|