C16H17N5O3 — CID 87036718
4-(2,5-dioxoimidazolidin-1-yl)-N-(2-pyrazol-1-ylphenyl)butanamide (PubChem CID 87036718) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-(2,5-dioxoimidazolidin-1-yl)-N-(2-pyrazol-1-ylphenyl)butanamide.
| Compound Name | 4-(2,5-dioxoimidazolidin-1-yl)-N-(2-pyrazol-1-ylphenyl)butanamide |
|---|---|
| PubChem CID | 87036718 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-(2,5-dioxoimidazolidin-1-yl)-N-(2-pyrazol-1-ylphenyl)butanamide |
| SMILES | O=C(CCCN1C(=O)CNC1=O)Nc1ccccc1-n1cccn1 |
| InChI | InChI=1S/C16H17N5O3/c22-14(7-3-9-20-15(23)11-17-16(20)24)19-12-5-1-2-6-13(12)21-10-4-8-18-21/h1-2,4-6,8,10H,3,7,9,11H2,(H,17,24)(H,19,22) |
| InChIKey | QXJLRQBLJRNEAP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|