C27H40N4O3 — CID 143414736
N-(2-aminophenyl)-6-(2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl)hexanamide;ethane;2-methylpropane (PubChem CID 143414736) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-(2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl)hexanamide;ethane;2-methylpropane.
| Compound Name | N-(2-aminophenyl)-6-(2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl)hexanamide;ethane;2-methylpropane |
|---|---|
| PubChem CID | 143414736 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | N-(2-aminophenyl)-6-(2,5-dioxo-3,4-dihydro-1,4-benzodiazepin-1-yl)hexanamide;ethane;2-methylpropane |
| SMILES | CC.CC(C)C.Nc1ccccc1NC(=O)CCCCCN1C(=O)CNC(=O)c2ccccc21 |
| InChI | InChI=1S/C21H24N4O3.C4H10.C2H6/c22-16-9-4-5-10-17(16)24-19(26)12-2-1-7-13-25-18-11-6-3-8-15(18)21(28)23-14-20(25)27;1-4(2)3;1-2/h3-6,8-11H,1-2,7,12-14,22H2,(H,23,28)(H,24,26);4H,1-3H3;1-2H3 |
| InChIKey | GNUQSSYVYIAJKR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|