C18H24N2O4 — CID 71359584
10-oxo-10-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]decanoic acid (PubChem CID 71359584) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 10-oxo-10-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]decanoic acid.
| Compound Name | 10-oxo-10-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]decanoic acid |
|---|---|
| PubChem CID | 71359584 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 10-oxo-10-[(1-oxo-2,3-dihydroisoindol-4-yl)amino]decanoic acid |
| SMILES | O=C(O)CCCCCCCCC(=O)Nc1cccc2c1CNC2=O |
| InChI | InChI=1S/C18H24N2O4/c21-16(10-5-3-1-2-4-6-11-17(22)23)20-15-9-7-8-13-14(15)12-19-18(13)24/h7-9H,1-6,10-12H2,(H,19,24)(H,20,21)(H,22,23) |
| InChIKey | NPSQFTIHLFEFHW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|