C22H19N3O4 — CID 39849507
3-(1,3-dioxoisoindol-2-yl)-N-(8-methoxy-2-methylquinolin-4-yl)propanamide (PubChem CID 39849507) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(8-methoxy-2-methylquinolin-4-yl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(8-methoxy-2-methylquinolin-4-yl)propanamide |
|---|---|
| PubChem CID | 39849507 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(8-methoxy-2-methylquinolin-4-yl)propanamide |
| SMILES | COc1cccc2c(NC(=O)CCN3C(=O)c4ccccc4C3=O)cc(C)nc12 |
| InChI | InChI=1S/C22H19N3O4/c1-13-12-17(16-8-5-9-18(29-2)20(16)23-13)24-19(26)10-11-25-21(27)14-6-3-4-7-15(14)22(25)28/h3-9,12H,10-11H2,1-2H3,(H,23,24,26) |
| InChIKey | LGOICVXSPJXUEN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|