C21H16FN3O3 — CID 39850954
3-(1,3-dioxoisoindol-2-yl)-N-(6-fluoro-2-methylquinolin-4-yl)propanamide (PubChem CID 39850954) has the molecular formula C21H16FN3O3 and a molecular weight of 377.38 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-(6-fluoro-2-methylquinolin-4-yl)propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-(6-fluoro-2-methylquinolin-4-yl)propanamide |
|---|---|
| PubChem CID | 39850954 |
| Molecular Formula | C21H16FN3O3 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-(6-fluoro-2-methylquinolin-4-yl)propanamide |
| SMILES | Cc1cc(NC(=O)CCN2C(=O)c3ccccc3C2=O)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C21H16FN3O3/c1-12-10-18(16-11-13(22)6-7-17(16)23-12)24-19(26)8-9-25-20(27)14-4-2-3-5-15(14)21(25)28/h2-7,10-11H,8-9H2,1H3,(H,23,24,26) |
| InChIKey | RYPQXWIUNCLUJF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|