C23H20N4O4 — CID 108764948
N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 108764948) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 108764948 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1cc(C)nc(Oc2ccc(NC(=O)CCN3C(=O)c4ccccc4C3=O)cc2)n1 |
| InChI | InChI=1S/C23H20N4O4/c1-14-13-15(2)25-23(24-14)31-17-9-7-16(8-10-17)26-20(28)11-12-27-21(29)18-5-3-4-6-19(18)22(27)30/h3-10,13H,11-12H2,1-2H3,(H,26,28) |
| InChIKey | HNPIRJOSZZEOSR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|