C22H21N3O3 — CID 108742508
N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-4-oxo-4-phenylbutanamide (PubChem CID 108742508) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-4-oxo-4-phenylbutanamide.
| Compound Name | N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-4-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 108742508 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-4-oxo-4-phenylbutanamide |
| SMILES | Cc1cc(C)nc(Oc2ccc(NC(=O)CCC(=O)c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C22H21N3O3/c1-15-14-16(2)24-22(23-15)28-19-10-8-18(9-11-19)25-21(27)13-12-20(26)17-6-4-3-5-7-17/h3-11,14H,12-13H2,1-2H3,(H,25,27) |
| InChIKey | CZVSPGUDULONSQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |