C21H19N3O4 — CID 108742520
methyl 2-[[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamoyl]benzoate (PubChem CID 108742520) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is methyl 2-[[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamoyl]benzoate.
| Compound Name | methyl 2-[[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 108742520 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | methyl 2-[[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(=O)Nc1ccc(Oc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C21H19N3O4/c1-13-12-14(2)23-21(22-13)28-16-10-8-15(9-11-16)24-19(25)17-6-4-5-7-18(17)20(26)27-3/h4-12H,1-3H3,(H,24,25) |
| InChIKey | BDGBAQUWRJIQAB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |