methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate

C14H15N3O3 — CID 108742490

IUPACmethyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate
SMILESCOC(=O)Nc1ccc(Oc2nc(C)cc(C)n2)cc1
InChIInChI=1S/C14H15N3O3/c1-9-8-10(2)16-13(15-9)20-12-6-4-11(5-7-12)17-14(18)19-3/h4-8H,1-3H3,(H,17,18)
InChIKeyPXHGLISOTRRFCD-UHFFFAOYSA-N
MW273.29 g/mol
LogP3.06
Rot. Bonds3

About methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate

methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate (PubChem CID 108742490) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate.

Molecular Properties

Compound Namemethyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate
PubChem CID108742490
Molecular FormulaC14H15N3O3
Molecular Weight273.29 g/mol
Exact Mass273.11
IUPAC Namemethyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate
SMILESCOC(=O)Nc1ccc(Oc2nc(C)cc(C)n2)cc1
InChIInChI=1S/C14H15N3O3/c1-9-8-10(2)16-13(15-9)20-12-6-4-11(5-7-12)17-14(18)19-3/h4-8H,1-3H3,(H,17,18)
InChIKeyPXHGLISOTRRFCD-UHFFFAOYSA-N
XLogP3.06
TPSA73.34 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.29
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate?
The IUPAC name of methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate (CID 108742490) is methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate.
What is the SMILES notation for methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate?
The canonical SMILES for methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate is COC(=O)Nc1ccc(Oc2nc(C)cc(C)n2)cc1.
What is the InChIKey of methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate?
The InChIKey is PXHGLISOTRRFCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3/c1-9-8-10(2)16-13(15-9)20-12-6-4-11(5-7-12)17-14(18)19-3/h4-8H,1-3H3,(H,17,18).
What are the key properties of methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate?
methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate has a molecular weight of 273.29 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate is sourced from PubChem (CID 108742490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).