C14H15N3O3 — CID 108742490
methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate (PubChem CID 108742490) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate.
| Compound Name | methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate |
|---|---|
| PubChem CID | 108742490 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | methyl N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(Oc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C14H15N3O3/c1-9-8-10(2)16-13(15-9)20-12-6-4-11(5-7-12)17-14(18)19-3/h4-8H,1-3H3,(H,17,18) |
| InChIKey | PXHGLISOTRRFCD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |