C19H15F2N3O2 — CID 108742551
N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-2,5-difluorobenzamide (PubChem CID 108742551) has the molecular formula C19H15F2N3O2 and a molecular weight of 355.34 g/mol. Its IUPAC name is N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-2,5-difluorobenzamide.
| Compound Name | N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 108742551 |
| Molecular Formula | C19H15F2N3O2 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[4-(4,6-dimethylpyrimidin-2-yl)oxyphenyl]-2,5-difluorobenzamide |
| SMILES | Cc1cc(C)nc(Oc2ccc(NC(=O)c3cc(F)ccc3F)cc2)n1 |
| InChI | InChI=1S/C19H15F2N3O2/c1-11-9-12(2)23-19(22-11)26-15-6-4-14(5-7-15)24-18(25)16-10-13(20)3-8-17(16)21/h3-10H,1-2H3,(H,24,25) |
| InChIKey | BBOWYQOENSSKMY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |