C26H27N5O3 — CID 108765888
N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-6-(1,3-dioxoisoindol-2-yl)hexanamide (PubChem CID 108765888) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-6-(1,3-dioxoisoindol-2-yl)hexanamide.
| Compound Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
|---|---|
| PubChem CID | 108765888 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-6-(1,3-dioxoisoindol-2-yl)hexanamide |
| SMILES | Cc1cc(C)nc(Nc2ccc(NC(=O)CCCCCN3C(=O)c4ccccc4C3=O)cc2)n1 |
| InChI | InChI=1S/C26H27N5O3/c1-17-16-18(2)28-26(27-17)30-20-13-11-19(12-14-20)29-23(32)10-4-3-7-15-31-24(33)21-8-5-6-9-22(21)25(31)34/h5-6,8-9,11-14,16H,3-4,7,10,15H2,1-2H3,(H,29,32)(H,27,28,30) |
| InChIKey | MMVCNYNFWPISLJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|