C27H30N6O3 — CID 122288373
N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 122288373) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 122288373 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | N-[4-[[4-(diethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | CCN(CC)c1cc(C)nc(Nc2ccc(NC(=O)CCCN3C(=O)c4ccccc4C3=O)cc2)n1 |
| InChI | InChI=1S/C27H30N6O3/c1-4-32(5-2)23-17-18(3)28-27(31-23)30-20-14-12-19(13-15-20)29-24(34)11-8-16-33-25(35)21-9-6-7-10-22(21)26(33)36/h6-7,9-10,12-15,17H,4-5,8,11,16H2,1-3H3,(H,29,34)(H,28,30,31) |
| InChIKey | DHHDENMVENWWJF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|