C28H21Cl2N3O4 — CID 19603314
N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 19603314) has the molecular formula C28H21Cl2N3O4 and a molecular weight of 534.40 g/mol. Its IUPAC name is N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 19603314 |
| Molecular Formula | C28H21Cl2N3O4 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(NC(=O)CCN4C(=O)c5ccccc5C4=O)c3Cl)c2n1 |
| InChI | InChI=1S/C28H21Cl2N3O4/c1-16-9-10-17-5-4-8-23(26(17)31-16)37-15-20-21(29)11-12-22(25(20)30)32-24(34)13-14-33-27(35)18-6-2-3-7-19(18)28(33)36/h2-12H,13-15H2,1H3,(H,32,34) |
| InChIKey | MBMCUQWPBNSSRE-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|