C22H20BrCl2N3O3 — CID 19603254
2-[(2-bromoacetyl)amino]-N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-N-methylacetamide (PubChem CID 19603254) has the molecular formula C22H20BrCl2N3O3 and a molecular weight of 525.23 g/mol. Its IUPAC name is 2-[(2-bromoacetyl)amino]-N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-N-methylacetamide.
| Compound Name | 2-[(2-bromoacetyl)amino]-N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 19603254 |
| Molecular Formula | C22H20BrCl2N3O3 |
| Molecular Weight | 525.23 g/mol |
| Exact Mass | 523.01 |
| IUPAC Name | 2-[(2-bromoacetyl)amino]-N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-N-methylacetamide |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(N(C)C(=O)CNC(=O)CBr)c3Cl)c2n1 |
| InChI | InChI=1S/C22H20BrCl2N3O3/c1-13-6-7-14-4-3-5-18(22(14)27-13)31-12-15-16(24)8-9-17(21(15)25)28(2)20(30)11-26-19(29)10-23/h3-9H,10-12H2,1-2H3,(H,26,29) |
| InChIKey | MBAGYWDANJNYCS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.23 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|