C29H27Cl2N5O4 — CID 22113388
N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-2-[[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]carbamoylamino]-N-methylacetamide (PubChem CID 22113388) has the molecular formula C29H27Cl2N5O4 and a molecular weight of 580.47 g/mol. Its IUPAC name is N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-2-[[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]carbamoylamino]-N-methylacetamide.
| Compound Name | N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-2-[[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]carbamoylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 22113388 |
| Molecular Formula | C29H27Cl2N5O4 |
| Molecular Weight | 580.47 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | N-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]-2-[[3-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenyl]carbamoylamino]-N-methylacetamide |
| SMILES | C/C(=N\O)c1cccc(NC(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4ccc(C)nc34)c2Cl)c1 |
| InChI | InChI=1S/C29H27Cl2N5O4/c1-17-10-11-19-6-5-9-25(28(19)33-17)40-16-22-23(30)12-13-24(27(22)31)36(3)26(37)15-32-29(38)34-21-8-4-7-20(14-21)18(2)35-39/h4-14,39H,15-16H2,1-3H3,(H2,32,34,38)/b35-18+ |
| InChIKey | OPNDQNCNRQKVFI-MWBNBJEGSA-N |
| XLogP | 6.41 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|