C17H16Cl4N2O — CID 22113140
2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]aniline;dihydrochloride (PubChem CID 22113140) has the molecular formula C17H16Cl4N2O and a molecular weight of 406.14 g/mol. Its IUPAC name is 2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]aniline;dihydrochloride.
| Compound Name | 2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 22113140 |
| Molecular Formula | C17H16Cl4N2O |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | 2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]aniline;dihydrochloride |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(N)c3Cl)c2n1.Cl.Cl |
| InChI | InChI=1S/C17H14Cl2N2O.2ClH/c1-10-5-6-11-3-2-4-15(17(11)21-10)22-9-12-13(18)7-8-14(20)16(12)19;;/h2-8H,9,20H2,1H3;2*1H |
| InChIKey | VOQFHIVAZVKLBF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|