C19H18Cl2N2O — CID 69109880
2,4-dichloro-N-ethyl-3-[(2-methylquinolin-8-yl)oxymethyl]aniline (PubChem CID 69109880) has the molecular formula C19H18Cl2N2O and a molecular weight of 361.27 g/mol. Its IUPAC name is 2,4-dichloro-N-ethyl-3-[(2-methylquinolin-8-yl)oxymethyl]aniline.
| Compound Name | 2,4-dichloro-N-ethyl-3-[(2-methylquinolin-8-yl)oxymethyl]aniline |
|---|---|
| PubChem CID | 69109880 |
| Molecular Formula | C19H18Cl2N2O |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2,4-dichloro-N-ethyl-3-[(2-methylquinolin-8-yl)oxymethyl]aniline |
| SMILES | CCNc1ccc(Cl)c(COc2cccc3ccc(C)nc23)c1Cl |
| InChI | InChI=1S/C19H18Cl2N2O/c1-3-22-16-10-9-15(20)14(18(16)21)11-24-17-6-4-5-13-8-7-12(2)23-19(13)17/h4-10,22H,3,11H2,1-2H3 |
| InChIKey | MPHODDGQYGDYCS-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |