C17H13Cl3N2O — CID 22113156
2,4-dichloro-3-[(4-chloro-2-methylquinolin-8-yl)oxymethyl]aniline (PubChem CID 22113156) has the molecular formula C17H13Cl3N2O and a molecular weight of 367.66 g/mol. Its IUPAC name is 2,4-dichloro-3-[(4-chloro-2-methylquinolin-8-yl)oxymethyl]aniline.
| Compound Name | 2,4-dichloro-3-[(4-chloro-2-methylquinolin-8-yl)oxymethyl]aniline |
|---|---|
| PubChem CID | 22113156 |
| Molecular Formula | C17H13Cl3N2O |
| Molecular Weight | 367.66 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2,4-dichloro-3-[(4-chloro-2-methylquinolin-8-yl)oxymethyl]aniline |
| SMILES | Cc1cc(Cl)c2cccc(OCc3c(Cl)ccc(N)c3Cl)c2n1 |
| InChI | InChI=1S/C17H13Cl3N2O/c1-9-7-13(19)10-3-2-4-15(17(10)22-9)23-8-11-12(18)5-6-14(21)16(11)20/h2-7H,8,21H2,1H3 |
| InChIKey | VMJHWVSSSIWPGP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|