About 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline
8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline (PubChem CID 141160203) has the molecular formula C22H22Cl2N2O3S
and a molecular weight of 465.40 g/mol. Its IUPAC name is 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline.
Molecular Properties
| Compound Name | 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline |
| PubChem CID | 141160203 |
| Molecular Formula | C22H22Cl2N2O3S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline |
| SMILES | Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)N4CCCC4)c3Cl)c2n1 |
| InChI | InChI=1S/C22H22Cl2N2O3S/c1-14-12-15(2)25-22-16(14)6-5-7-19(22)29-13-17-18(23)8-9-20(21(17)24)30(27,28)26-10-3-4-11-26/h5-9,12H,3-4,10-11,13H2,1-2H3 |
| InChIKey | KFOYNHMEMWQYTP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline?
The IUPAC name of 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline (CID 141160203) is 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline.
What is the SMILES notation for 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline?
The canonical SMILES for 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline is Cc1cc(C)c2cccc(OCc3c(Cl)ccc(S(=O)(=O)N4CCCC4)c3Cl)c2n1.
What is the InChIKey of 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline?
The InChIKey is KFOYNHMEMWQYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22Cl2N2O3S/c1-14-12-15(2)25-22-16(14)6-5-7-19(22)29-13-17-18(23)8-9-20(21(17)24)30(27,28)26-10-3-4-11-26/h5-9,12H,3-4,10-11,13H2,1-2H3.
What are the key properties of 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline?
8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline has a molecular weight of 465.40 g/mol, XLogP of 5.52, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2,6-dichloro-3-pyrrolidin-1-ylsulfonylphenyl)methoxy]-2,4-dimethylquinoline is sourced from PubChem (CID 141160203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).