C32H33Cl2N5O4S — CID 18782249
N-[2-(4-carbamimidoylphenyl)ethyl]-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 18782249) has the molecular formula C32H33Cl2N5O4S and a molecular weight of 654.62 g/mol. Its IUPAC name is N-[2-(4-carbamimidoylphenyl)ethyl]-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[2-(4-carbamimidoylphenyl)ethyl]-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18782249 |
| Molecular Formula | C32H33Cl2N5O4S |
| Molecular Weight | 654.62 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | N-[2-(4-carbamimidoylphenyl)ethyl]-1-[2,4-dichloro-3-[(2,4-dimethylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CCNC(=O)C2CCCN2S(=O)(=O)c2ccc(Cl)c(COc3cccc4c(C)cc(C)nc34)c2Cl)cc1 |
| InChI | InChI=1S/C32H33Cl2N5O4S/c1-19-17-20(2)38-30-23(19)5-3-7-27(30)43-18-24-25(33)12-13-28(29(24)34)44(41,42)39-16-4-6-26(39)32(40)37-15-14-21-8-10-22(11-9-21)31(35)36/h3,5,7-13,17,26H,4,6,14-16,18H2,1-2H3,(H3,35,36)(H,37,40) |
| InChIKey | UNQTYQGQGQTUKG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.62 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|