C32H33Cl2N7O6S — CID 18739650
(2S)-N-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-1-[2,4-dichloro-3-[(2-methyl-4-oxopyrido[1,2-a]pyrimidin-9-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 18739650) has the molecular formula C32H33Cl2N7O6S and a molecular weight of 714.63 g/mol. Its IUPAC name is (2S)-N-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-1-[2,4-dichloro-3-[(2-methyl-4-oxopyrido[1,2-a]pyrimidin-9-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-1-[2,4-dichloro-3-[(2-methyl-4-oxopyrido[1,2-a]pyrimidin-9-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18739650 |
| Molecular Formula | C32H33Cl2N7O6S |
| Molecular Weight | 714.63 g/mol |
| Exact Mass | 713.16 |
| IUPAC Name | (2S)-N-[3-[(4-carbamimidoylbenzoyl)amino]propyl]-1-[2,4-dichloro-3-[(2-methyl-4-oxopyrido[1,2-a]pyrimidin-9-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCCNC(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(Cl)c(COc3cccn4c(=O)cc(C)nc34)c2Cl)cc1 |
| InChI | InChI=1S/C32H33Cl2N7O6S/c1-19-17-27(42)40-15-3-6-25(30(40)39-19)47-18-22-23(33)11-12-26(28(22)34)48(45,46)41-16-2-5-24(41)32(44)38-14-4-13-37-31(43)21-9-7-20(8-10-21)29(35)36/h3,6-12,15,17,24H,2,4-5,13-14,16,18H2,1H3,(H3,35,36)(H,37,43)(H,38,44)/t24-/m0/s1 |
| InChIKey | JLQFEVKWGNOIGF-DEOSSOPVSA-N |
| XLogP | 3.26 |
| TPSA | 189.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|