C33H34Cl2N6O6S — CID 54353219
(2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[3-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]propyl]pyrrolidine-2-carboxamide (PubChem CID 54353219) has the molecular formula C33H34Cl2N6O6S and a molecular weight of 713.64 g/mol. Its IUPAC name is (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[3-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]propyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[3-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]propyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54353219 |
| Molecular Formula | C33H34Cl2N6O6S |
| Molecular Weight | 713.64 g/mol |
| Exact Mass | 712.16 |
| IUPAC Name | (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[3-[[4-(N'-hydroxycarbamimidoyl)benzoyl]amino]propyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(S(=O)(=O)N4CCC[C@H]4C(=O)NCCCNC(=O)c4ccc(C(N)=NO)cc4)c3Cl)c2n1 |
| InChI | InChI=1S/C33H34Cl2N6O6S/c1-20-8-9-21-5-2-7-27(30(21)39-20)47-19-24-25(34)14-15-28(29(24)35)48(45,46)41-18-3-6-26(41)33(43)38-17-4-16-37-32(42)23-12-10-22(11-13-23)31(36)40-44/h2,5,7-15,26,44H,3-4,6,16-19H2,1H3,(H2,36,40)(H,37,42)(H,38,43)/t26-/m0/s1 |
| InChIKey | UHFXRUGZMLUGKQ-SANMLTNESA-N |
| XLogP | 4.61 |
| TPSA | 176.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|