C30H29Cl2N5O4S — CID 70195637
(2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[(4-methanehydrazonoylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 70195637) has the molecular formula C30H29Cl2N5O4S and a molecular weight of 626.57 g/mol. Its IUPAC name is (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[(4-methanehydrazonoylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[(4-methanehydrazonoylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70195637 |
| Molecular Formula | C30H29Cl2N5O4S |
| Molecular Weight | 626.57 g/mol |
| Exact Mass | 625.13 |
| IUPAC Name | (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[(4-methanehydrazonoylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(S(=O)(=O)N4CCC[C@H]4C(=O)NCc4ccc(C=NN)cc4)c3Cl)c2n1 |
| InChI | InChI=1S/C30H29Cl2N5O4S/c1-19-7-12-22-4-2-6-26(29(22)36-19)41-18-23-24(31)13-14-27(28(23)32)42(39,40)37-15-3-5-25(37)30(38)34-16-20-8-10-21(11-9-20)17-35-33/h2,4,6-14,17,25H,3,5,15-16,18,33H2,1H3,(H,34,38)/t25-/m0/s1 |
| InChIKey | XLEGGWOLTDFQNW-VWLOTQADSA-N |
| XLogP | 5.19 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.57 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|