C37H40Cl2N6O5S — CID 70196506
(2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[[1-[2-(4-methanehydrazonoylphenyl)acetyl]piperidin-4-yl]methyl]pyrrolidine-2-carboxamide (PubChem CID 70196506) has the molecular formula C37H40Cl2N6O5S and a molecular weight of 751.74 g/mol. Its IUPAC name is (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[[1-[2-(4-methanehydrazonoylphenyl)acetyl]piperidin-4-yl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[[1-[2-(4-methanehydrazonoylphenyl)acetyl]piperidin-4-yl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70196506 |
| Molecular Formula | C37H40Cl2N6O5S |
| Molecular Weight | 751.74 g/mol |
| Exact Mass | 750.22 |
| IUPAC Name | (2S)-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonyl-N-[[1-[2-(4-methanehydrazonoylphenyl)acetyl]piperidin-4-yl]methyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(S(=O)(=O)N4CCC[C@H]4C(=O)NCC4CCN(C(=O)Cc5ccc(C=NN)cc5)CC4)c3Cl)c2n1 |
| InChI | InChI=1S/C37H40Cl2N6O5S/c1-24-7-12-28-4-2-6-32(36(28)43-24)50-23-29-30(38)13-14-33(35(29)39)51(48,49)45-17-3-5-31(45)37(47)41-21-27-15-18-44(19-16-27)34(46)20-25-8-10-26(11-9-25)22-42-40/h2,4,6-14,22,27,31H,3,5,15-21,23,40H2,1H3,(H,41,47)/t31-/m0/s1 |
| InChIKey | GVSNUNROLNWMFC-HKBQPEDESA-N |
| XLogP | 5.47 |
| TPSA | 147.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|