C26H30Cl2N6O4S — CID 70197212
(2S)-N-[3-(diaminomethylideneamino)propyl]-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 70197212) has the molecular formula C26H30Cl2N6O4S and a molecular weight of 593.54 g/mol. Its IUPAC name is (2S)-N-[3-(diaminomethylideneamino)propyl]-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-(diaminomethylideneamino)propyl]-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70197212 |
| Molecular Formula | C26H30Cl2N6O4S |
| Molecular Weight | 593.54 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | (2S)-N-[3-(diaminomethylideneamino)propyl]-1-[2,4-dichloro-3-[(2-methylquinolin-8-yl)oxymethyl]phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1ccc2cccc(OCc3c(Cl)ccc(S(=O)(=O)N4CCC[C@H]4C(=O)NCCCN=C(N)N)c3Cl)c2n1 |
| InChI | InChI=1S/C26H30Cl2N6O4S/c1-16-8-9-17-5-2-7-21(24(17)33-16)38-15-18-19(27)10-11-22(23(18)28)39(36,37)34-14-3-6-20(34)25(35)31-12-4-13-32-26(29)30/h2,5,7-11,20H,3-4,6,12-15H2,1H3,(H,31,35)(H4,29,30,32)/t20-/m0/s1 |
| InChIKey | QCRAAEPWKCSUNU-FQEVSTJZSA-N |
| XLogP | 3.36 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|